C18H17N3O — CID 40521418
(2S)-1,1-diphenyl-2-(1,2,4-triazol-1-yl)but-3-en-1-ol (PubChem CID 40521418) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (2S)-1,1-diphenyl-2-(1,2,4-triazol-1-yl)but-3-en-1-ol.
| Compound Name | (2S)-1,1-diphenyl-2-(1,2,4-triazol-1-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 40521418 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2S)-1,1-diphenyl-2-(1,2,4-triazol-1-yl)but-3-en-1-ol |
| SMILES | C=C[C@H](n1cncn1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O/c1-2-17(21-14-19-13-20-21)18(22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h2-14,17,22H,1H2/t17-/m0/s1 |
| InChIKey | DPPGMVHXXRQNNI-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|