About (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline
(3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline (PubChem CID 40526138) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 40526138 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline |
| SMILES | C[C@H]1Cc2ccccc2N(C)C1 |
| InChI | InChI=1S/C11H15N/c1-9-7-10-5-3-4-6-11(10)12(2)8-9/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | CLQQYBXJWOTWCS-VIFPVBQESA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline?
The IUPAC name of (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline (CID 40526138) is (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline is C[C@H]1Cc2ccccc2N(C)C1.
What is the InChIKey of (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline?
The InChIKey is CLQQYBXJWOTWCS-VIFPVBQESA-N. The full InChI is InChI=1S/C11H15N/c1-9-7-10-5-3-4-6-11(10)12(2)8-9/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1.
What are the key properties of (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline?
(3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline has a molecular weight of 161.25 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,3-dimethyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 40526138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).