C24H19NO2 — CID 40527431
(2S)-2-(furan-2-yl)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazine (PubChem CID 40527431) has the molecular formula C24H19NO2 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazine.
| Compound Name | (2S)-2-(furan-2-yl)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazine |
|---|---|
| PubChem CID | 40527431 |
| Molecular Formula | C24H19NO2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (2S)-2-(furan-2-yl)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazine |
| SMILES | c1ccc(C2(c3ccccc3)O[C@@H](c3ccco3)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H19NO2/c1-3-10-18(11-4-1)24(19-12-5-2-6-13-19)20-14-7-8-15-21(20)25-23(27-24)22-16-9-17-26-22/h1-17,23,25H/t23-/m0/s1 |
| InChIKey | DCZHJBLDUSQNDJ-QHCPKHFHSA-N |
| XLogP | 5.71 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |