C10H21NO — CID 40530694
(3R)-N,N,3,4,4-pentamethylpentanamide (PubChem CID 40530694) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (3R)-N,N,3,4,4-pentamethylpentanamide.
| Compound Name | (3R)-N,N,3,4,4-pentamethylpentanamide |
|---|---|
| PubChem CID | 40530694 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (3R)-N,N,3,4,4-pentamethylpentanamide |
| SMILES | C[C@H](CC(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-8(10(2,3)4)7-9(12)11(5)6/h8H,7H2,1-6H3/t8-/m1/s1 |
| InChIKey | YMUNKAWYPKXSSN-MRVPVSSYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |