C12H21ClN2O — CID 40530963
N-[(1S,2S)-2-chlorocyclohexyl]piperidine-1-carboxamide (PubChem CID 40530963) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is N-[(1S,2S)-2-chlorocyclohexyl]piperidine-1-carboxamide.
| Compound Name | N-[(1S,2S)-2-chlorocyclohexyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 40530963 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N-[(1S,2S)-2-chlorocyclohexyl]piperidine-1-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1Cl)N1CCCCC1 |
| InChI | InChI=1S/C12H21ClN2O/c13-10-6-2-3-7-11(10)14-12(16)15-8-4-1-5-9-15/h10-11H,1-9H2,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | YFONBSXDRJXHMY-QWRGUYRKSA-N |
| XLogP | 2.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|