C29H25BrCl2N2O7 — CID 4053437
2-(4-bromophenyl)-6a,9a-dichloro-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4053437) has the molecular formula C29H25BrCl2N2O7 and a molecular weight of 664.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6a,9a-dichloro-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-bromophenyl)-6a,9a-dichloro-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4053437 |
| Molecular Formula | C29H25BrCl2N2O7 |
| Molecular Weight | 664.34 g/mol |
| Exact Mass | 662.02 |
| IUPAC Name | 2-(4-bromophenyl)-6a,9a-dichloro-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)c(C2C3=CCC4C(=O)N(c5ccc(Br)cc5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)c(OC)c1 |
| InChI | InChI=1S/C29H25BrCl2N2O7/c1-33-26(38)28(31)12-18-16(8-9-17-21(18)25(37)34(24(17)36)14-6-4-13(30)5-7-14)23(29(28,32)27(33)39)22-19(35)10-15(40-2)11-20(22)41-3/h4-8,10-11,17-18,21,23,35H,9,12H2,1-3H3 |
| InChIKey | BPSRSYSXJFZMNG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|