About (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione
(5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione (PubChem CID 40534384) has the molecular formula C4H6N2O2S
and a molecular weight of 146.17 g/mol. Its IUPAC name is (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione |
| PubChem CID | 40534384 |
| Molecular Formula | C4H6N2O2S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](CS)N1 |
| InChI | InChI=1S/C4H6N2O2S/c7-3-2(1-9)5-4(8)6-3/h2,9H,1H2,(H2,5,6,7,8)/t2-/m0/s1 |
| InChIKey | OTZNOKBPJBCNJO-REOHCLBHSA-N |
| XLogP | -0.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione?
The IUPAC name of (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione (CID 40534384) is (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione.
What is the SMILES notation for (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione?
The canonical SMILES for (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione is O=C1NC(=O)[C@H](CS)N1.
What is the InChIKey of (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione?
The InChIKey is OTZNOKBPJBCNJO-REOHCLBHSA-N. The full InChI is InChI=1S/C4H6N2O2S/c7-3-2(1-9)5-4(8)6-3/h2,9H,1H2,(H2,5,6,7,8)/t2-/m0/s1.
What are the key properties of (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione?
(5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione has a molecular weight of 146.17 g/mol, XLogP of -0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(sulfanylmethyl)imidazolidine-2,4-dione is sourced from PubChem (CID 40534384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).