C28H22N2O2S — CID 4053442
N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-phenylmethoxybenzamide (PubChem CID 4053442) has the molecular formula C28H22N2O2S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 4053442 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-phenylmethoxybenzamide |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)cc1NC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2O2S/c1-19-11-12-22(28-30-24-9-5-6-10-26(24)33-28)17-25(19)29-27(31)21-13-15-23(16-14-21)32-18-20-7-3-2-4-8-20/h2-17H,18H2,1H3,(H,29,31) |
| InChIKey | SDHBHZWUHBSAFH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |