About 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one
1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 4053467) has the molecular formula C26H21N3O2
and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 4053467 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | Cc1oc(-c2ccccc2)nc1CN1C(=O)CN=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H21N3O2/c1-18-22(28-26(31-18)20-12-6-3-7-13-20)17-29-23-15-9-8-14-21(23)25(27-16-24(29)30)19-10-4-2-5-11-19/h2-15H,16-17H2,1H3 |
| InChIKey | CLBJTMLZXUDMPQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one (CID 4053467) is 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one is Cc1oc(-c2ccccc2)nc1CN1C(=O)CN=C(c2ccccc2)c2ccccc21.
What is the InChIKey of 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is CLBJTMLZXUDMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O2/c1-18-22(28-26(31-18)20-12-6-3-7-13-20)17-29-23-15-9-8-14-21(23)25(27-16-24(29)30)19-10-4-2-5-11-19/h2-15H,16-17H2,1H3.
What are the key properties of 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one?
1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 407.47 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 4053467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).