C18H37ClO2S — CID 40535153
(2R,3R)-3-chloro-2-[2-(2-hexylsulfanylethoxy)ethoxy]octane (PubChem CID 40535153) has the molecular formula C18H37ClO2S and a molecular weight of 353.01 g/mol. Its IUPAC name is (2R,3R)-3-chloro-2-[2-(2-hexylsulfanylethoxy)ethoxy]octane.
| Compound Name | (2R,3R)-3-chloro-2-[2-(2-hexylsulfanylethoxy)ethoxy]octane |
|---|---|
| PubChem CID | 40535153 |
| Molecular Formula | C18H37ClO2S |
| Molecular Weight | 353.01 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2R,3R)-3-chloro-2-[2-(2-hexylsulfanylethoxy)ethoxy]octane |
| SMILES | CCCCCCSCCOCCO[C@H](C)[C@H](Cl)CCCCC |
| InChI | InChI=1S/C18H37ClO2S/c1-4-6-8-10-15-22-16-14-20-12-13-21-17(3)18(19)11-9-7-5-2/h17-18H,4-16H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | DZLFLEUUQTVQSN-QZTJIDSGSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.01 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|