C13H25ClOS — CID 40535157
cis-(1S,2R)-1-chloro-2-(2-hexylsulfanylethoxy)cyclopentane (PubChem CID 40535157) has the molecular formula C13H25ClOS and a molecular weight of 264.86 g/mol. Its IUPAC name is cis-(1S,2R)-1-chloro-2-(2-hexylsulfanylethoxy)cyclopentane.
| Compound Name | cis-(1S,2R)-1-chloro-2-(2-hexylsulfanylethoxy)cyclopentane |
|---|---|
| PubChem CID | 40535157 |
| Molecular Formula | C13H25ClOS |
| Molecular Weight | 264.86 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | cis-(1S,2R)-1-chloro-2-(2-hexylsulfanylethoxy)cyclopentane |
| SMILES | CCCCCCSCCO[C@@H]1CCC[C@@H]1Cl |
| InChI | InChI=1S/C13H25ClOS/c1-2-3-4-5-10-16-11-9-15-13-8-6-7-12(13)14/h12-13H,2-11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | WEZKFLVRFUVHRY-QWHCGFSZSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|