C22H21ClN2O5 — CID 4053690
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4053690) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4053690 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(C)N1C(=O)c2ccc(C(=O)OCC(=O)Nc3cccc(Cl)c3C)cc2C1=O |
| InChI | InChI=1S/C22H21ClN2O5/c1-4-12(2)25-20(27)15-9-8-14(10-16(15)21(25)28)22(29)30-11-19(26)24-18-7-5-6-17(23)13(18)3/h5-10,12H,4,11H2,1-3H3,(H,24,26) |
| InChIKey | BPKMJEWZGKZZSD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|