C16H24ClNO2 — CID 40537766
(2S)-2-(3-chlorophenoxy)-N-[(2R)-heptan-2-yl]propanamide (PubChem CID 40537766) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-[(2R)-heptan-2-yl]propanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-[(2R)-heptan-2-yl]propanamide |
|---|---|
| PubChem CID | 40537766 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-[(2R)-heptan-2-yl]propanamide |
| SMILES | CCCCC[C@@H](C)NC(=O)[C@H](C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClNO2/c1-4-5-6-8-12(2)18-16(19)13(3)20-15-10-7-9-14(17)11-15/h7,9-13H,4-6,8H2,1-3H3,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | GIBCRBMOULWAPI-OLZOCXBDSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|