C16H23NO2 — CID 40537881
[(2R,6R)-2,6-dimethylpiperidin-1-yl]-(2-ethoxyphenyl)methanone (PubChem CID 40537881) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethylpiperidin-1-yl]-(2-ethoxyphenyl)methanone.
| Compound Name | [(2R,6R)-2,6-dimethylpiperidin-1-yl]-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 40537881 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | [(2R,6R)-2,6-dimethylpiperidin-1-yl]-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)N1[C@H](C)CCC[C@H]1C |
| InChI | InChI=1S/C16H23NO2/c1-4-19-15-11-6-5-10-14(15)16(18)17-12(2)8-7-9-13(17)3/h5-6,10-13H,4,7-9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | HSJUDPOOECGDOE-CHWSQXEVSA-N |
| XLogP | 3.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |