About (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine
(4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 40538053) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 40538053 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC[C@@H]1CSC(N(C)C)=N1 |
| InChI | InChI=1S/C7H14N2S/c1-4-6-5-10-7(8-6)9(2)3/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | XUDSJTHNRKMXBF-ZCFIWIBFSA-N |
| XLogP | 1.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine (CID 40538053) is (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine is CC[C@@H]1CSC(N(C)C)=N1.
What is the InChIKey of (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is XUDSJTHNRKMXBF-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14N2S/c1-4-6-5-10-7(8-6)9(2)3/h6H,4-5H2,1-3H3/t6-/m1/s1.
What are the key properties of (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
(4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 158.27 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-ethyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 40538053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).