C10H12F7NO2 — CID 40538958
2,2,3,3,4,4,4-heptafluoro-N-[(1S,2S)-2-hydroxycyclohexyl]butanamide (PubChem CID 40538958) has the molecular formula C10H12F7NO2 and a molecular weight of 311.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[(1S,2S)-2-hydroxycyclohexyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[(1S,2S)-2-hydroxycyclohexyl]butanamide |
|---|---|
| PubChem CID | 40538958 |
| Molecular Formula | C10H12F7NO2 |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[(1S,2S)-2-hydroxycyclohexyl]butanamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F7NO2/c11-8(12,9(13,14)10(15,16)17)7(20)18-5-3-1-2-4-6(5)19/h5-6,19H,1-4H2,(H,18,20)/t5-,6-/m0/s1 |
| InChIKey | WCIZYAPQAVSMFT-WDSKDSINSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|