About (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one
(2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one (PubChem CID 40539861) has the molecular formula C14H10O5S
and a molecular weight of 290.30 g/mol. Its IUPAC name is (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one.
Molecular Properties
| Compound Name | (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one |
| PubChem CID | 40539861 |
| Molecular Formula | C14H10O5S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one |
| SMILES | O=C1c2cc(O)c(O)cc2S(=O)(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H10O5S/c15-10-6-9-12(7-11(10)16)20(18,19)14(13(9)17)8-4-2-1-3-5-8/h1-7,14-16H/t14-/m1/s1 |
| InChIKey | OTVWLMVAISAZBX-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one?
The IUPAC name of (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one (CID 40539861) is (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one.
What is the SMILES notation for (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one?
The canonical SMILES for (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one is O=C1c2cc(O)c(O)cc2S(=O)(=O)[C@@H]1c1ccccc1.
What is the InChIKey of (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one?
The InChIKey is OTVWLMVAISAZBX-CQSZACIVSA-N. The full InChI is InChI=1S/C14H10O5S/c15-10-6-9-12(7-11(10)16)20(18,19)14(13(9)17)8-4-2-1-3-5-8/h1-7,14-16H/t14-/m1/s1.
What are the key properties of (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one?
(2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one has a molecular weight of 290.30 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5,6-dihydroxy-1,1-dioxo-2-phenyl-1-benzothiophen-3-one is sourced from PubChem (CID 40539861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).