About methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate
methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate (PubChem CID 4053992) has the molecular formula C10H14F3NO3
and a molecular weight of 253.22 g/mol. Its IUPAC name is methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 4053992 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO3/c1-17-8(15)6-2-4-7(5-3-6)14-9(16)10(11,12)13/h6-7H,2-5H2,1H3,(H,14,16) |
| InChIKey | YZPGQWUQSJGAOD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate (CID 4053992) is methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate is COC(=O)C1CCC(NC(=O)C(F)(F)F)CC1.
What is the InChIKey of methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate?
The InChIKey is YZPGQWUQSJGAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO3/c1-17-8(15)6-2-4-7(5-3-6)14-9(16)10(11,12)13/h6-7H,2-5H2,1H3,(H,14,16).
What are the key properties of methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate?
methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate has a molecular weight of 253.22 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 4053992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).