C16H15ClFNOS — CID 40541480
(2R,3R)-3-chloro-3-(4-fluorophenyl)-2-methylsulfanyl-N-phenylpropanamide (PubChem CID 40541480) has the molecular formula C16H15ClFNOS and a molecular weight of 323.82 g/mol. Its IUPAC name is (2R,3R)-3-chloro-3-(4-fluorophenyl)-2-methylsulfanyl-N-phenylpropanamide.
| Compound Name | (2R,3R)-3-chloro-3-(4-fluorophenyl)-2-methylsulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 40541480 |
| Molecular Formula | C16H15ClFNOS |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (2R,3R)-3-chloro-3-(4-fluorophenyl)-2-methylsulfanyl-N-phenylpropanamide |
| SMILES | CS[C@H](C(=O)Nc1ccccc1)[C@H](Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15ClFNOS/c1-21-15(14(17)11-7-9-12(18)10-8-11)16(20)19-13-5-3-2-4-6-13/h2-10,14-15H,1H3,(H,19,20)/t14-,15+/m1/s1 |
| InChIKey | TZNYNQVETZQGOU-CABCVRRESA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|