About N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine
N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine (PubChem CID 40542024) has the molecular formula C23H23N3
and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine.
Molecular Properties
| Compound Name | N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine |
| PubChem CID | 40542024 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine |
| SMILES | c1ccc(CNCN2N=C(c3ccccc3)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3/c1-4-10-19(11-5-1)17-24-18-26-23(21-14-8-3-9-15-21)16-22(25-26)20-12-6-2-7-13-20/h1-15,23-24H,16-18H2/t23-/m0/s1 |
| InChIKey | QLNYXSZSBGQDLK-QHCPKHFHSA-N |
| XLogP | 4.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine?
The IUPAC name of N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine (CID 40542024) is N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine.
What is the SMILES notation for N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine?
The canonical SMILES for N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine is c1ccc(CNCN2N=C(c3ccccc3)C[C@H]2c2ccccc2)cc1.
What is the InChIKey of N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine?
The InChIKey is QLNYXSZSBGQDLK-QHCPKHFHSA-N. The full InChI is InChI=1S/C23H23N3/c1-4-10-19(11-5-1)17-24-18-26-23(21-14-8-3-9-15-21)16-22(25-26)20-12-6-2-7-13-20/h1-15,23-24H,16-18H2/t23-/m0/s1.
What are the key properties of N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine?
N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine has a molecular weight of 341.46 g/mol, XLogP of 4.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]methyl]-1-phenylmethanamine is sourced from PubChem (CID 40542024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).