About 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde
1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde (PubChem CID 40542280) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde |
| PubChem CID | 40542280 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde |
| SMILES | Cc1cc(C)c(OC[C@H](O)Cn2cc(C=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H23NO3/c1-14-8-15(2)21(16(3)9-14)25-13-18(24)11-22-10-17(12-23)19-6-4-5-7-20(19)22/h4-10,12,18,24H,11,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | XQGGAQDCVQIMOQ-GOSISDBHSA-N |
| XLogP | 3.82 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde?
The IUPAC name of 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde (CID 40542280) is 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde.
What is the SMILES notation for 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde?
The canonical SMILES for 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde is Cc1cc(C)c(OC[C@H](O)Cn2cc(C=O)c3ccccc32)c(C)c1.
What is the InChIKey of 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde?
The InChIKey is XQGGAQDCVQIMOQ-GOSISDBHSA-N. The full InChI is InChI=1S/C21H23NO3/c1-14-8-15(2)21(16(3)9-14)25-13-18(24)11-22-10-17(12-23)19-6-4-5-7-20(19)22/h4-10,12,18,24H,11,13H2,1-3H3/t18-/m1/s1.
What are the key properties of 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde?
1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde has a molecular weight of 337.42 g/mol, XLogP of 3.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde is sourced from PubChem (CID 40542280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).