C21H23NO3 — CID 40542280
1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde (PubChem CID 40542280) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde.
| Compound Name | 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 40542280 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]indole-3-carbaldehyde |
| SMILES | Cc1cc(C)c(OC[C@H](O)Cn2cc(C=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H23NO3/c1-14-8-15(2)21(16(3)9-14)25-13-18(24)11-22-10-17(12-23)19-6-4-5-7-20(19)22/h4-10,12,18,24H,11,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | XQGGAQDCVQIMOQ-GOSISDBHSA-N |
| XLogP | 3.82 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|