C16H15NO2 — CID 40542856
[(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-pyridin-2-ylmethanone (PubChem CID 40542856) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is [(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-pyridin-2-ylmethanone.
| Compound Name | [(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 40542856 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-pyridin-2-ylmethanone |
| SMILES | COc1ccc([C@H]2C[C@@H]2C(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-19-12-7-5-11(6-8-12)13-10-14(13)16(18)15-4-2-3-9-17-15/h2-9,13-14H,10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | SNKCTYVWANLSOA-KGLIPLIRSA-N |
| XLogP | 3.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |