About (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine
(4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 40543534) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine.
Analyze (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine (CID 40543534) is (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine is C[C@@H]1CSC(N(C)C)=N1.
What is the InChIKey of (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is NAUHWJYUCJXLMI-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H12N2S/c1-5-4-9-6(7-5)8(2)3/h5H,4H2,1-3H3/t5-/m1/s1.
What are the key properties of (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
(4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 144.24 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N,N,4-trimethyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 40543534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).