C10H11ClN4 — CID 40543905
(2R,3R)-3-amino-2-[(2-chlorophenyl)diazenyl]butanenitrile (PubChem CID 40543905) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is (2R,3R)-3-amino-2-[(2-chlorophenyl)diazenyl]butanenitrile.
| Compound Name | (2R,3R)-3-amino-2-[(2-chlorophenyl)diazenyl]butanenitrile |
|---|---|
| PubChem CID | 40543905 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2R,3R)-3-amino-2-[(2-chlorophenyl)diazenyl]butanenitrile |
| SMILES | C[C@@H](N)[C@H](C#N)/N=N/c1ccccc1Cl |
| InChI | InChI=1S/C10H11ClN4/c1-7(13)10(6-12)15-14-9-5-3-2-4-8(9)11/h2-5,7,10H,13H2,1H3/b15-14+/t7-,10+/m1/s1 |
| InChIKey | SDTSNYVMCFDKPY-LPUPQANFSA-N |
| XLogP | 2.66 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|