C16H20NS2+ — CID 40543941
1-methyl-1-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione (PubChem CID 40543941) has the molecular formula C16H20NS2+ and a molecular weight of 290.48 g/mol. Its IUPAC name is 1-methyl-1-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione.
| Compound Name | 1-methyl-1-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione |
|---|---|
| PubChem CID | 40543941 |
| Molecular Formula | C16H20NS2+ |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-methyl-1-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione |
| SMILES | C[C@H](c1ccccc1)[N+]1(C)SC(=S)C2=C1CCCC2 |
| InChI | InChI=1S/C16H20NS2/c1-12(13-8-4-3-5-9-13)17(2)15-11-7-6-10-14(15)16(18)19-17/h3-5,8-9,12H,6-7,10-11H2,1-2H3/q+1/t12-,17?/m1/s1 |
| InChIKey | CQBDXYYWYKHWPD-MTATWXBHSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|