C20H22FN2O2S+ — CID 4054514
3-(2-fluoro-4-methoxyphenyl)-1-(3-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol (PubChem CID 4054514) has the molecular formula C20H22FN2O2S+ and a molecular weight of 373.47 g/mol. Its IUPAC name is 3-(2-fluoro-4-methoxyphenyl)-1-(3-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol.
| Compound Name | 3-(2-fluoro-4-methoxyphenyl)-1-(3-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
|---|---|
| PubChem CID | 4054514 |
| Molecular Formula | C20H22FN2O2S+ |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 3-(2-fluoro-4-methoxyphenyl)-1-(3-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
| SMILES | COc1ccc(C2(O)CN(c3cccc(C)c3)C3=[N+]2CCCS3)c(F)c1 |
| InChI | InChI=1S/C20H22FN2O2S/c1-14-5-3-6-15(11-14)22-13-20(24,23-9-4-10-26-19(22)23)17-8-7-16(25-2)12-18(17)21/h3,5-8,11-12,24H,4,9-10,13H2,1-2H3/q+1 |
| InChIKey | HKTBELAJXILBPV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|