C21H23N2OS+ — CID 4054746
1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium (PubChem CID 4054746) has the molecular formula C21H23N2OS+ and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium.
| Compound Name | 1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium |
|---|---|
| PubChem CID | 4054746 |
| Molecular Formula | C21H23N2OS+ |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium |
| SMILES | CCOc1ccc(-c2c[n+]3c(n2Cc2ccccc2)SCCC3)cc1 |
| InChI | InChI=1S/C21H23N2OS/c1-2-24-19-11-9-18(10-12-19)20-16-22-13-6-14-25-21(22)23(20)15-17-7-4-3-5-8-17/h3-5,7-12,16H,2,6,13-15H2,1H3/q+1 |
| InChIKey | MXQFMGZSSPKBMT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|