About (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid
(2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 40549038) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 40549038 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCC[C@@H]1N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C7H13NO2S/c1-2-3-6-8-5(4-11-6)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6+/m0/s1 |
| InChIKey | QIJPWSGHURHDHJ-NTSWFWBYSA-N |
| XLogP | 0.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid (CID 40549038) is (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid is CCC[C@@H]1N[C@H](C(=O)O)CS1.
What is the InChIKey of (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is QIJPWSGHURHDHJ-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-2-3-6-8-5(4-11-6)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6+/m0/s1.
What are the key properties of (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid?
(2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 175.25 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-propyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 40549038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).