About 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one
3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one (PubChem CID 4054923) has the molecular formula C15H15NO3S2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one |
| PubChem CID | 4054923 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)CSC2c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C15H15NO3S2/c1-18-10-5-6-11(12(8-10)19-2)16-14(17)9-21-15(16)13-4-3-7-20-13/h3-8,15H,9H2,1-2H3 |
| InChIKey | ZTAPCUYRMSRJPW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one (CID 4054923) is 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one is COc1ccc(N2C(=O)CSC2c2cccs2)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
The InChIKey is ZTAPCUYRMSRJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3S2/c1-18-10-5-6-11(12(8-10)19-2)16-14(17)9-21-15(16)13-4-3-7-20-13/h3-8,15H,9H2,1-2H3.
What are the key properties of 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one has a molecular weight of 321.42 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 4054923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).