C24H26N2O3S — CID 4055058
N-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4055058) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4055058 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(3-methoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(NCc3cccc(OC)c3)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-28-18-12-10-17(11-13-18)26-23(27)22-20-8-3-4-9-21(20)30-24(22)25-15-16-6-5-7-19(14-16)29-2/h5-7,10-14,25H,3-4,8-9,15H2,1-2H3,(H,26,27) |
| InChIKey | MNNPGQBCATUTQJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_H(2)', 'substructure': 'N/A'} |
|---|