C9H10F7NO2 — CID 40551150
2,2,3,3,4,4,4-heptafluoro-N-[[(2R)-oxolan-2-yl]methyl]butanamide (PubChem CID 40551150) has the molecular formula C9H10F7NO2 and a molecular weight of 297.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[[(2R)-oxolan-2-yl]methyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 40551150 |
| Molecular Formula | C9H10F7NO2 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
| SMILES | O=C(NC[C@H]1CCCO1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F7NO2/c10-7(11,8(12,13)9(14,15)16)6(18)17-4-5-2-1-3-19-5/h5H,1-4H2,(H,17,18)/t5-/m1/s1 |
| InChIKey | UXUULZBMUREGDR-RXMQYKEDSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|