C8H15N3O3S — CID 40553895
(2R)-1-(2-hydroxyethoxy)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol (PubChem CID 40553895) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is (2R)-1-(2-hydroxyethoxy)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol.
| Compound Name | (2R)-1-(2-hydroxyethoxy)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 40553895 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2R)-1-(2-hydroxyethoxy)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol |
| SMILES | Cn1cnnc1SC[C@H](O)COCCO |
| InChI | InChI=1S/C8H15N3O3S/c1-11-6-9-10-8(11)15-5-7(13)4-14-3-2-12/h6-7,12-13H,2-5H2,1H3/t7-/m1/s1 |
| InChIKey | VVNPDCPDPVSCOE-SSDOTTSWSA-N |
| XLogP | -0.72 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|