C43H39N3O7 — CID 4055488
2-(4-ethenylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4055488) has the molecular formula C43H39N3O7 and a molecular weight of 709.80 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-ethenylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4055488 |
| Molecular Formula | C43H39N3O7 |
| Molecular Weight | 709.80 g/mol |
| Exact Mass | 709.28 |
| IUPAC Name | 2-(4-ethenylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(Nc6ccc(C)cc6)C(=O)C5(c5ccccc5)C4c4c(O)cc(OC)cc4OC)C3C2=O)cc1 |
| InChI | InChI=1S/C43H39N3O7/c1-5-25-13-17-28(18-14-25)45-39(48)31-20-19-30-32(36(31)41(45)50)23-33-40(49)46(44-27-15-11-24(2)12-16-27)42(51)43(33,26-9-7-6-8-10-26)38(30)37-34(47)21-29(52-3)22-35(37)53-4/h5-19,21-22,31-33,36,38,44,47H,1,20,23H2,2-4H3 |
| InChIKey | VZYBJNJPQDAPKT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.80 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|