C22H24O4 — CID 4055527
(10-acetyloxy-6,14-dimethyl-2-tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaenyl) acetate (PubChem CID 4055527) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (10-acetyloxy-6,14-dimethyl-2-tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaenyl) acetate.
| Compound Name | (10-acetyloxy-6,14-dimethyl-2-tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaenyl) acetate |
|---|---|
| PubChem CID | 4055527 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (10-acetyloxy-6,14-dimethyl-2-tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaenyl) acetate |
| SMILES | CC(=O)OC1Cc2cc(C)ccc2C(OC(C)=O)Cc2cc(C)ccc21 |
| InChI | InChI=1S/C22H24O4/c1-13-5-7-19-17(9-13)11-21(25-15(3)23)20-8-6-14(2)10-18(20)12-22(19)26-16(4)24/h5-10,21-22H,11-12H2,1-4H3 |
| InChIKey | UUSCQQVMVQKFMU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |