C26H25BrN4OS — CID 4055695
1-[5-bromo-2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 4055695) has the molecular formula C26H25BrN4OS and a molecular weight of 521.48 g/mol. Its IUPAC name is 1-[5-bromo-2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-[5-bromo-2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4055695 |
| Molecular Formula | C26H25BrN4OS |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 1-[5-bromo-2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | Cc1cccc(Cn2c(O)c(/N=N/C(=S)Nc3c(C)cc(C)cc3C)c3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C26H25BrN4OS/c1-15-6-5-7-19(12-15)14-31-22-9-8-20(27)13-21(22)24(25(31)32)29-30-26(33)28-23-17(3)10-16(2)11-18(23)4/h5-13,32H,14H2,1-4H3,(H,28,33)/b30-29+ |
| InChIKey | VECUKUSKPLDLOC-QVIHXGFCSA-N |
| XLogP | 7.87 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|