C9H12O — CID 40557881
(1R,2S,4R,6R)-1-ethyltricyclo[2.2.1.02,6]heptan-3-one (PubChem CID 40557881) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (1R,2S,4R,6R)-1-ethyltricyclo[2.2.1.02,6]heptan-3-one.
| Compound Name | (1R,2S,4R,6R)-1-ethyltricyclo[2.2.1.02,6]heptan-3-one |
|---|---|
| PubChem CID | 40557881 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (1R,2S,4R,6R)-1-ethyltricyclo[2.2.1.02,6]heptan-3-one |
| SMILES | CC[C@@]12C[C@H]3C[C@@H]1[C@@H]2C3=O |
| InChI | InChI=1S/C9H12O/c1-2-9-4-5-3-6(9)7(9)8(5)10/h5-7H,2-4H2,1H3/t5-,6-,7-,9-/m1/s1 |
| InChIKey | MNJJRQCQJWAHEI-JXOAFFINSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |