C11H15N3S — CID 40559244
(1S,8R)-1,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2,6-diene-5-thione (PubChem CID 40559244) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is (1S,8R)-1,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2,6-diene-5-thione.
| Compound Name | (1S,8R)-1,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2,6-diene-5-thione |
|---|---|
| PubChem CID | 40559244 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (1S,8R)-1,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2,6-diene-5-thione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1n[nH]c(=S)nc12 |
| InChI | InChI=1S/C11H15N3S/c1-10(2)6-4-5-11(10,3)8-7(6)12-9(15)14-13-8/h6H,4-5H2,1-3H3,(H,12,14,15)/t6-,11+/m0/s1 |
| InChIKey | UJACBIJGKMHVFB-UPONEAKYSA-N |
| XLogP | 2.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|