C10H12O3S — CID 40559816
(5S)-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-ol (PubChem CID 40559816) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is (5S)-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-ol.
| Compound Name | (5S)-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-ol |
|---|---|
| PubChem CID | 40559816 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (5S)-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-ol |
| SMILES | O=S1(=O)CCC[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C10H12O3S/c11-9-5-3-7-14(12,13)10-6-2-1-4-8(9)10/h1-2,4,6,9,11H,3,5,7H2/t9-/m0/s1 |
| InChIKey | FSEYHWQLJZBUCB-VIFPVBQESA-N |
| XLogP | 1.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |