C13H27NO2 — CID 4055982
4-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 4055982) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 4-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 4-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 4055982 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 4-butyl-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CCCCC1(O)CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C13H27NO2/c1-6-7-8-13(15)9-11(2,3)14(16)12(4,5)10-13/h15-16H,6-10H2,1-5H3 |
| InChIKey | XQTRXLFGGPLUMX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |