About (3S)-1,1-dimethoxy-3,7-dimethyloctane
(3S)-1,1-dimethoxy-3,7-dimethyloctane (PubChem CID 40561591) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is (3S)-1,1-dimethoxy-3,7-dimethyloctane.
Molecular Properties
| Compound Name | (3S)-1,1-dimethoxy-3,7-dimethyloctane |
| PubChem CID | 40561591 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (3S)-1,1-dimethoxy-3,7-dimethyloctane |
| SMILES | COC(C[C@@H](C)CCCC(C)C)OC |
| InChI | InChI=1S/C12H26O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h10-12H,6-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | YKJOVWRPIHPSDM-NSHDSACASA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,1-dimethoxy-3,7-dimethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,1-dimethoxy-3,7-dimethyloctane?
The IUPAC name of (3S)-1,1-dimethoxy-3,7-dimethyloctane (CID 40561591) is (3S)-1,1-dimethoxy-3,7-dimethyloctane.
What is the SMILES notation for (3S)-1,1-dimethoxy-3,7-dimethyloctane?
The canonical SMILES for (3S)-1,1-dimethoxy-3,7-dimethyloctane is COC(C[C@@H](C)CCCC(C)C)OC.
What is the InChIKey of (3S)-1,1-dimethoxy-3,7-dimethyloctane?
The InChIKey is YKJOVWRPIHPSDM-NSHDSACASA-N. The full InChI is InChI=1S/C12H26O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h10-12H,6-9H2,1-5H3/t11-/m0/s1.
What are the key properties of (3S)-1,1-dimethoxy-3,7-dimethyloctane?
(3S)-1,1-dimethoxy-3,7-dimethyloctane has a molecular weight of 202.34 g/mol, XLogP of 3.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,1-dimethoxy-3,7-dimethyloctane is sourced from PubChem (CID 40561591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).