About [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium
[(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium (PubChem CID 40561855) has the molecular formula C10H18N+
and a molecular weight of 152.26 g/mol. Its IUPAC name is [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium.
Molecular Properties
| Compound Name | [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium |
| PubChem CID | 40561855 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@@]1([NH3+])C2 |
| InChI | InChI=1S/C10H17N/c1-7-9(2,3)8-4-5-10(7,11)6-8/h8H,1,4-6,11H2,2-3H3/p+1/t8-,10-/m1/s1 |
| InChIKey | DRECVDVROUTDNN-PSASIEDQSA-O |
| XLogP | 1.36 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium?
The IUPAC name of [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium (CID 40561855) is [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium.
What is the SMILES notation for [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium?
The canonical SMILES for [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium is C=C1C(C)(C)[C@@H]2CC[C@@]1([NH3+])C2.
What is the InChIKey of [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium?
The InChIKey is DRECVDVROUTDNN-PSASIEDQSA-O. The full InChI is InChI=1S/C10H17N/c1-7-9(2,3)8-4-5-10(7,11)6-8/h8H,1,4-6,11H2,2-3H3/p+1/t8-,10-/m1/s1.
What are the key properties of [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium?
[(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium has a molecular weight of 152.26 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]azanium is sourced from PubChem (CID 40561855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).