About but-3-enimidamide
but-3-enimidamide (PubChem CID 4056230) has the molecular formula C4H8N2
and a molecular weight of 84.12 g/mol. Its IUPAC name is but-3-enimidamide.
Molecular Properties
| Compound Name | but-3-enimidamide |
| PubChem CID | 4056230 |
| Molecular Formula | C4H8N2 |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | but-3-enimidamide |
| SMILES | [H]/N=C(/N)CC=C |
| InChI | InChI=1S/C4H8N2/c1-2-3-4(5)6/h2H,1,3H2,(H3,5,6) |
| InChIKey | HBZBZNLEVRPSRL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enimidamide?
The IUPAC name of but-3-enimidamide (CID 4056230) is but-3-enimidamide.
What is the SMILES notation for but-3-enimidamide?
The canonical SMILES for but-3-enimidamide is [H]/N=C(/N)CC=C.
What is the InChIKey of but-3-enimidamide?
The InChIKey is HBZBZNLEVRPSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2/c1-2-3-4(5)6/h2H,1,3H2,(H3,5,6).
What are the key properties of but-3-enimidamide?
but-3-enimidamide has a molecular weight of 84.12 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enimidamide is sourced from PubChem (CID 4056230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).