About (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol
(1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol (PubChem CID 40566517) has the molecular formula C6H12Cl3O4P
and a molecular weight of 285.49 g/mol. Its IUPAC name is (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol.
Molecular Properties
| Compound Name | (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol |
| PubChem CID | 40566517 |
| Molecular Formula | C6H12Cl3O4P |
| Molecular Weight | 285.49 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol |
| SMILES | CCOP(=O)(OCC)[C@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H12Cl3O4P/c1-3-12-14(11,13-4-2)5(10)6(7,8)9/h5,10H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | FGQNUVIUWZJVCR-YFKPBYRVSA-N |
| XLogP | 2.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol?
The IUPAC name of (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol (CID 40566517) is (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol.
What is the SMILES notation for (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol?
The canonical SMILES for (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol is CCOP(=O)(OCC)[C@H](O)C(Cl)(Cl)Cl.
What is the InChIKey of (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol?
The InChIKey is FGQNUVIUWZJVCR-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12Cl3O4P/c1-3-12-14(11,13-4-2)5(10)6(7,8)9/h5,10H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol?
(1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol has a molecular weight of 285.49 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2,2-trichloro-1-diethoxyphosphorylethanol is sourced from PubChem (CID 40566517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).