C18H21ClN4OS — CID 40568364
2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 40568364) has the molecular formula C18H21ClN4OS and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 40568364 |
| Molecular Formula | C18H21ClN4OS |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1cccc(Cl)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H21ClN4OS/c19-15-7-4-8-16(11-15)23-13-21-22-18(23)25-12-17(24)20-10-9-14-5-2-1-3-6-14/h4-5,7-8,11,13H,1-3,6,9-10,12H2,(H,20,24) |
| InChIKey | XUSGQGFSUVNCEG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|