C11H15NO3 — CID 40569411
(1S,6R)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 40569411) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (1S,6R)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40569411 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (1S,6R)-6-(cyclopropylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NC1CC1 |
| InChI | InChI=1S/C11H15NO3/c13-10(12-7-5-6-7)8-3-1-2-4-9(8)11(14)15/h1-2,7-9H,3-6H2,(H,12,13)(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | IGBLGCCLFYDMDG-BDAKNGLRSA-N |
| XLogP | 0.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|