C17H10N2O3S — CID 40569432
(10S)-8-amino-2-oxo-10-thiophen-2-yl-10H-pyrano[2,3-f]chromene-9-carbonitrile (PubChem CID 40569432) has the molecular formula C17H10N2O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is (10S)-8-amino-2-oxo-10-thiophen-2-yl-10H-pyrano[2,3-f]chromene-9-carbonitrile.
| Compound Name | (10S)-8-amino-2-oxo-10-thiophen-2-yl-10H-pyrano[2,3-f]chromene-9-carbonitrile |
|---|---|
| PubChem CID | 40569432 |
| Molecular Formula | C17H10N2O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (10S)-8-amino-2-oxo-10-thiophen-2-yl-10H-pyrano[2,3-f]chromene-9-carbonitrile |
| SMILES | N#CC1=C(N)Oc2ccc3ccc(=O)oc3c2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C17H10N2O3S/c18-8-10-14(12-2-1-7-23-12)15-11(21-17(10)19)5-3-9-4-6-13(20)22-16(9)15/h1-7,14H,19H2/t14-/m0/s1 |
| InChIKey | OJGHHPNXOXJIMJ-AWEZNQCLSA-N |
| XLogP | 3.07 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|