C22H31NO2 — CID 40573046
N-[(1S,2R)-2-(furan-2-ylmethyl)cyclohexyl]adamantane-1-carboxamide (PubChem CID 40573046) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[(1S,2R)-2-(furan-2-ylmethyl)cyclohexyl]adamantane-1-carboxamide.
| Compound Name | N-[(1S,2R)-2-(furan-2-ylmethyl)cyclohexyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 40573046 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | N-[(1S,2R)-2-(furan-2-ylmethyl)cyclohexyl]adamantane-1-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1Cc1ccco1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H31NO2/c24-21(22-12-15-8-16(13-22)10-17(9-15)14-22)23-20-6-2-1-4-18(20)11-19-5-3-7-25-19/h3,5,7,15-18,20H,1-2,4,6,8-14H2,(H,23,24)/t15?,16?,17?,18-,20+,22?/m1/s1 |
| InChIKey | YZNHXAKNDQHQQV-YFBMGZMASA-N |
| XLogP | 4.71 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |