C13H14F3NO4 — CID 40573861
ethyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 40573861) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 40573861 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO4/c1-2-20-11(18)10(13(14,15)16)17-12(19)21-8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | SMCDAJVQRNYHRN-SNVBAGLBSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |