C12H15NO2S — CID 40574393
(2S,4S)-2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 40574393) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (2S,4S)-2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2S,4S)-2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 40574393 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2S,4S)-2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | Cc1ccc([C@H]2N[C@@H](C(=O)O)CS2)c(C)c1 |
| InChI | InChI=1S/C12H15NO2S/c1-7-3-4-9(8(2)5-7)11-13-10(6-16-11)12(14)15/h3-5,10-11,13H,6H2,1-2H3,(H,14,15)/t10-,11+/m1/s1 |
| InChIKey | WTDGOGLHWOAHSL-MNOVXSKESA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |