C24H20N2O3S — CID 4057633
methyl 2-(4-benzylbenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4057633) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is methyl 2-(4-benzylbenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(4-benzylbenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4057633 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl 2-(4-benzylbenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)s/c(=N\C(=O)c1ccc(Cc3ccccc3)cc1)n2C |
| InChI | InChI=1S/C24H20N2O3S/c1-26-20-13-12-19(23(28)29-2)15-21(20)30-24(26)25-22(27)18-10-8-17(9-11-18)14-16-6-4-3-5-7-16/h3-13,15H,14H2,1-2H3/b25-24- |
| InChIKey | PBEJRDBAMCXQQJ-IZHYLOQSSA-N |
| XLogP | 4.36 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |